CAS 2340294-64-4 is the registry number for 4-Bromo-3-iodo-1-cyclopentyl-1h-pyrrolo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-1-cyclopentyl-3-iodopyrrolo[2,3-b]pyridine (CAS 2340294-64-4) is a chemical compound with the molecular formula C12H12BrIN2 and a molecular weight of 391.05 g/mol. IUPAC name: 4-bromo-1-cyclopentyl-3-iodopyrrolo[2,3-b]pyridine. InChIKey: IHMIFNDGBPREAZ-UHFFFAOYSA-N.
| Molecular formula | C12H12BrIN2 |
|---|---|
| Molecular weight | 391.05 g/mol |
| IUPAC name | 4-bromo-1-cyclopentyl-3-iodopyrrolo[2,3-b]pyridine |
| InChIKey | IHMIFNDGBPREAZ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C=C(C3=C(C=CN=C32)Br)I |
Computed by PubChem (NCBI)