Products 23403-47-6
CAS 23403-47-6 is the registry number for (4S)-5-methoxy-5-oxo-4-[(2,2,2-trifluoroacetyl)amino]pentanoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
(4S)-5-methoxy-5-oxo-4-[(2,2,2-trifluoroacetyl)amino]pentanoic acid (CAS 23403-47-6) is a chemical compound with the molecular formula C8H10F3NO5 and a molecular weight of 257.16 g/mol. IUPAC name: (4S)-5-methoxy-5-oxo-4-[(2,2,2-trifluoroacetyl)amino]pentanoic acid. InChIKey: LQZDXJJDSZEPFX-BYPYZUCNSA-N.
| Molecular formula | C8H10F3NO5 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | (4S)-5-methoxy-5-oxo-4-[(2,2,2-trifluoroacetyl)amino]pentanoic acid |
| InChIKey | LQZDXJJDSZEPFX-BYPYZUCNSA-N |
| SMILES | COC(=O)[C@H](CCC(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)