CAS 2309465-00-5 is the registry number for 2,2,2-Trifluoroacetic acid compound with 4-amino-2-oxabicyclo[2.1.1]hexane-1-carboxylic acid (1:1), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-2-oxabicyclo[2.1.1]hexane-1-carboxylic acid;2,2,2-trifluoroacetic acid (CAS 2309465-00-5) is a chemical compound with the molecular formula C8H10F3NO5 and a molecular weight of 257.16 g/mol. IUPAC name: 4-amino-2-oxabicyclo[2.1.1]hexane-1-carboxylic acid;2,2,2-trifluoroacetic acid. InChIKey: MVXKLMISGZRHML-UHFFFAOYSA-N.
| Molecular formula | C8H10F3NO5 |
|---|---|
| Molecular weight | 257.16 g/mol |
| IUPAC name | 4-amino-2-oxabicyclo[2.1.1]hexane-1-carboxylic acid;2,2,2-trifluoroacetic acid |
| InChIKey | MVXKLMISGZRHML-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(OC2)C(=O)O)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)