Products 2343963-64-2
CAS 2343963-64-2 is the registry number for (1R)-2,2-Difluoro-1-(furan-2-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1R)-2,2-difluoro-1-(furan-2-yl)ethanamine;hydrochloride (CAS 2343963-64-2) is a chemical compound with the molecular formula C6H8ClF2NO and a molecular weight of 183.58 g/mol. IUPAC name: (1R)-2,2-difluoro-1-(furan-2-yl)ethanamine;hydrochloride. InChIKey: BFAILEZOAJHMRD-NUBCRITNSA-N.
| Molecular formula | C6H8ClF2NO |
|---|---|
| Molecular weight | 183.58 g/mol |
| IUPAC name | (1R)-2,2-difluoro-1-(furan-2-yl)ethanamine;hydrochloride |
| InChIKey | BFAILEZOAJHMRD-NUBCRITNSA-N |
| SMILES | C1=COC(=C1)[C@H](C(F)F)N.Cl |
Computed by PubChem (NCBI)