CAS 234434-08-3 is the registry number for Sodium 2,2,2-trifluoroethane-1-sulfinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 2,2,2-trifluoroethanesulfinate (CAS 234434-08-3) is a chemical compound with the molecular formula C2H2F3NaO2S and a molecular weight of 170.09 g/mol. IUPAC name: sodium 2,2,2-trifluoroethanesulfinate. InChIKey: QBYZFENBJAXDLI-UHFFFAOYSA-M.
| Molecular formula | C2H2F3NaO2S |
|---|---|
| Molecular weight | 170.09 g/mol |
| IUPAC name | sodium 2,2,2-trifluoroethanesulfinate |
| InChIKey | QBYZFENBJAXDLI-UHFFFAOYSA-M |
| SMILES | C(C(F)(F)F)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)