CAS 2344679-97-4 appears in our catalog under these names: (3-(Aminomethyl)phenyl)dimethylphosphine oxide hydrochloride, 98%, (3-(Dimethylphosphoryl)phenyl)methanamine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
(3-dimethylphosphorylphenyl)methanamine;hydrochloride (CAS 2344679-97-4) is a chemical compound with the molecular formula C9H15ClNOP and a molecular weight of 219.65 g/mol. IUPAC name: (3-dimethylphosphorylphenyl)methanamine;hydrochloride. InChIKey: YBGPLZHEGKVNRI-UHFFFAOYSA-N.
| Molecular formula | C9H15ClNOP |
|---|---|
| Molecular weight | 219.65 g/mol |
| IUPAC name | (3-dimethylphosphorylphenyl)methanamine;hydrochloride |
| InChIKey | YBGPLZHEGKVNRI-UHFFFAOYSA-N |
| SMILES | CP(=O)(C)C1=CC=CC(=C1)CN.Cl |
Computed by PubChem (NCBI)