CAS 2344680-51-7 is the registry number for tert-Butyl 1-fluoro-5-formyl-3-azabicyclo[3.1.1]heptane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 1-fluoro-5-formyl-3-azabicyclo[3.1.1]heptane-3-carboxylate (CAS 2344680-51-7) is a chemical compound with the molecular formula C12H18FNO3 and a molecular weight of 243.27 g/mol. IUPAC name: tert-butyl 1-fluoro-5-formyl-3-azabicyclo[3.1.1]heptane-3-carboxylate. InChIKey: WMGVVACFAUMAHK-UHFFFAOYSA-N.
| Molecular formula | C12H18FNO3 |
|---|---|
| Molecular weight | 243.27 g/mol |
| IUPAC name | tert-butyl 1-fluoro-5-formyl-3-azabicyclo[3.1.1]heptane-3-carboxylate |
| InChIKey | WMGVVACFAUMAHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC(C2)(C1)F)C=O |
Computed by PubChem (NCBI)