CAS 2344685-36-3 appears in our catalog under these names: Dimethyl(piperidin-4-ylimino)-l6-sulfanone dihydrochloride, 98%, 98%, Dimethyl(piperidin-4-ylimino)-l6-sulfanone dihydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Dimethyl-oxo-piperidin-4-ylimino-lambda6-sulfane;dihydrochloride (CAS 2344685-36-3) is a chemical compound with the molecular formula C7H18Cl2N2OS and a molecular weight of 249.20 g/mol. IUPAC name: dimethyl-oxo-piperidin-4-ylimino-lambda6-sulfane;dihydrochloride. InChIKey: DOICFEKSOKOVAG-UHFFFAOYSA-N.
| Molecular formula | C7H18Cl2N2OS |
|---|---|
| Molecular weight | 249.20 g/mol |
| IUPAC name | dimethyl-oxo-piperidin-4-ylimino-lambda6-sulfane;dihydrochloride |
| InChIKey | DOICFEKSOKOVAG-UHFFFAOYSA-N |
| SMILES | CS(=NC1CCNCC1)(=O)C.Cl.Cl |
Computed by PubChem (NCBI)