Products 2344685-76-1

CAS 2344685-76-1 is the registry number for 6-Chloro-4-methylpyridazin-3-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.

Structural formula: {0} (CAS {1})

6-chloro-4-methylpyridazin-3-amine;hydrochloride (CAS 2344685-76-1) is a chemical compound with the molecular formula C5H7Cl2N3 and a molecular weight of 180.03 g/mol. IUPAC name: 6-chloro-4-methylpyridazin-3-amine;hydrochloride. InChIKey: FIDCUEZZRHOUTC-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7Cl2N3
Molecular weight180.03 g/mol
IUPAC name6-chloro-4-methylpyridazin-3-amine;hydrochloride
InChIKeyFIDCUEZZRHOUTC-UHFFFAOYSA-N
SMILESCC1=CC(=NN=C1N)Cl.Cl

Computed by PubChem (NCBI)