CAS 2344692-57-3 is the registry number for tert-Butyl 4-(5-(N'-hydroxycarbamimidoyl)pyrazin-2-yl)piperazine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate (CAS 2344692-57-3) is a chemical compound with the molecular formula C14H22N6O3 and a molecular weight of 322.36 g/mol. IUPAC name: tert-butyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate. InChIKey: PSLZWYUVXMVEIK-UHFFFAOYSA-N.
| Molecular formula | C14H22N6O3 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | tert-butyl 4-[5-[(Z)-N'-hydroxycarbamimidoyl]pyrazin-2-yl]piperazine-1-carboxylate |
| InChIKey | PSLZWYUVXMVEIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=C(N=C2)/C(=N/O)/N |
Computed by PubChem (NCBI)