CAS 23451-98-1 appears in our catalog under these names: 2-Amino-5-nitrobenzenethiol, 97%, 2-amino-5-nitrobenzenethiol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 2,5g.
2-amino-5-nitrobenzenethiol (CAS 23451-98-1) is a chemical compound with the molecular formula C6H6N2O2S and a molecular weight of 170.19 g/mol. IUPAC name: 2-amino-5-nitrobenzenethiol. InChIKey: UJDSRXSZJCJVCS-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O2S |
|---|---|
| Molecular weight | 170.19 g/mol |
| IUPAC name | 2-amino-5-nitrobenzenethiol |
| InChIKey | UJDSRXSZJCJVCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])S)N |
Computed by PubChem (NCBI)