CAS 2346512-57-8 appears in our catalog under these names: (1-BENZYLINDOL-5-YL)BORONIC ACID, 96%, 96%, (1-Benzylindol-5-yl)boronic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1-benzylindol-5-yl)boronic acid (CAS 2346512-57-8) is a chemical compound with the molecular formula C15H14BNO2 and a molecular weight of 251.09 g/mol. IUPAC name: (1-benzylindol-5-yl)boronic acid. InChIKey: JKACPKHWZZGGJB-UHFFFAOYSA-N.
| Molecular formula | C15H14BNO2 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | (1-benzylindol-5-yl)boronic acid |
| InChIKey | JKACPKHWZZGGJB-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C=C2)CC3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)