CAS 2347-47-9 appears in our catalog under these names: 2,3-Dichloro-N,N-dimethylquinoxaline-6-sulfonamide, 98%, 2,3-Dichloro-N,N-dimethylquinoxaline-6-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 500mg, 50mg, 100mg, 250mg, 1000mg.
2,3-dichloro-N,N-dimethylquinoxaline-6-sulfonamide (CAS 2347-47-9) is a chemical compound with the molecular formula C10H9Cl2N3O2S and a molecular weight of 306.17 g/mol. IUPAC name: 2,3-dichloro-N,N-dimethylquinoxaline-6-sulfonamide. InChIKey: ODSUZZOFDSXGGP-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2N3O2S |
|---|---|
| Molecular weight | 306.17 g/mol |
| IUPAC name | 2,3-dichloro-N,N-dimethylquinoxaline-6-sulfonamide |
| InChIKey | ODSUZZOFDSXGGP-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC2=C(C=C1)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)