CAS 23481-50-7 is the registry number for 1,9-Dimethylmethylene blue, 98.06%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 250 mg, 10 mg, 100 mg.
[7-(dimethylamino)-1,9-dimethylphenothiazin-3-ylidene]-dimethylazanium chloride (CAS 23481-50-7) is a chemical compound with the molecular formula C18H22ClN3S and a molecular weight of 347.9 g/mol. IUPAC name: [7-(dimethylamino)-1,9-dimethylphenothiazin-3-ylidene]-dimethylazanium chloride. InChIKey: JRMSLDWZFJZLAS-UHFFFAOYSA-M.
| Molecular formula | C18H22ClN3S |
|---|---|
| Molecular weight | 347.9 g/mol |
| IUPAC name | [7-(dimethylamino)-1,9-dimethylphenothiazin-3-ylidene]-dimethylazanium chloride |
| InChIKey | JRMSLDWZFJZLAS-UHFFFAOYSA-M |
| SMILES | CC1=CC(=CC2=C1N=C3C(=CC(=[N+](C)C)C=C3S2)C)N(C)C.[Cl-] |
Computed by PubChem (NCBI)