Products 23481-50-7

CAS 23481-50-7 is the registry number for 1,9-Dimethylmethylene blue, 98.06%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 250 mg, 10 mg, 100 mg.

Structural formula: {0} (CAS {1})

[7-(dimethylamino)-1,9-dimethylphenothiazin-3-ylidene]-dimethylazanium chloride (CAS 23481-50-7) is a chemical compound with the molecular formula C18H22ClN3S and a molecular weight of 347.9 g/mol. IUPAC name: [7-(dimethylamino)-1,9-dimethylphenothiazin-3-ylidene]-dimethylazanium chloride. InChIKey: JRMSLDWZFJZLAS-UHFFFAOYSA-M.

Identity
Molecular formulaC18H22ClN3S
Molecular weight347.9 g/mol
IUPAC name[7-(dimethylamino)-1,9-dimethylphenothiazin-3-ylidene]-dimethylazanium chloride
InChIKeyJRMSLDWZFJZLAS-UHFFFAOYSA-M
SMILESCC1=CC(=CC2=C1N=C3C(=CC(=[N+](C)C)C=C3S2)C)N(C)C.[Cl-]

Computed by PubChem (NCBI)