Products 23483-93-4

CAS 23483-93-4 appears in our catalog under these names: bis(1-propylguanidine) sulfuric acid, 95%, Bis(1-propylguanidine), sulfuric acid, 95%, Bis(1-propylguanidine), sulfuric acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.

Structural formula: {0} (CAS {1})

Bis(2-propylguanidine);sulfuric acid (CAS 23483-93-4) is a chemical compound with the molecular formula C8H24N6O4S and a molecular weight of 300.38 g/mol. IUPAC name: bis(2-propylguanidine);sulfuric acid. InChIKey: VZKCJJUATTWLTC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H24N6O4S
Molecular weight300.38 g/mol
IUPAC namebis(2-propylguanidine);sulfuric acid
InChIKeyVZKCJJUATTWLTC-UHFFFAOYSA-N
SMILESCCCN=C(N)N.CCCN=C(N)N.OS(=O)(=O)O

Computed by PubChem (NCBI)