CAS 2348566-35-6 is the registry number for S24–14. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(1,3-benzothiazol-2-ylcarbamoyl)naphthalene-2-carboxylic acid (CAS 2348566-35-6) is a chemical compound with the molecular formula C19H12N2O3S and a molecular weight of 348.4 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-ylcarbamoyl)naphthalene-2-carboxylic acid. InChIKey: PVYHQMYBFXCIFZ-UHFFFAOYSA-N.
| Molecular formula | C19H12N2O3S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 3-(1,3-benzothiazol-2-ylcarbamoyl)naphthalene-2-carboxylic acid |
| InChIKey | PVYHQMYBFXCIFZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NC3=NC4=CC=CC=C4S3)C(=O)O |
Computed by PubChem (NCBI)