Products 2349358-81-0
CAS 2349358-81-0 appears in our catalog under these names: 1-Propionyl-Lysergic Acid Diethylamide, >95% (HPLC), 1P–LSD (solution), 1-Propionyl-lysergic acid diethylamide. Offered by: TRC, GLPBio, Biosynth. Available pack sizes: 1mg, 2,5mg, 25mg, 100μg, 5mg, 10mg, 50mg.
(6aR,9R)-N,N-diethyl-7-methyl-4-propanoyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide (CAS 2349358-81-0) is a chemical compound with the molecular formula C23H29N3O2 and a molecular weight of 379.5 g/mol. IUPAC name: (6aR,9R)-N,N-diethyl-7-methyl-4-propanoyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide. InChIKey: JSMQOVGXBIDBIE-OXQOHEQNSA-N.
| Molecular formula | C23H29N3O2 |
|---|---|
| Molecular weight | 379.5 g/mol |
| IUPAC name | (6aR,9R)-N,N-diethyl-7-methyl-4-propanoyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxamide |
| InChIKey | JSMQOVGXBIDBIE-OXQOHEQNSA-N |
| SMILES | CCC(=O)N1C=C2C[C@@H]3C(=C[C@H](CN3C)C(=O)N(CC)CC)C4=C2C1=CC=C4 |
Computed by PubChem (NCBI)