Products 2349416-79-9
CAS 2349416-79-9 is the registry number for (R)-2-(Fmoc-amino)-6-(4-Fluorophenyl)hexanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(4-fluorophenyl)hexanoic acid (CAS 2349416-79-9) is a chemical compound with the molecular formula C27H26FNO4 and a molecular weight of 447.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(4-fluorophenyl)hexanoic acid. InChIKey: GAQQXZZLZUXYCQ-RUZDIDTESA-N.
| Molecular formula | C27H26FNO4 |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(4-fluorophenyl)hexanoic acid |
| InChIKey | GAQQXZZLZUXYCQ-RUZDIDTESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCCCC4=CC=C(C=C4)F)C(=O)O |
Computed by PubChem (NCBI)