Products 2349772-26-3
CAS 2349772-26-3 is the registry number for (2s)-2-[4-(trifluoromethyl)phenyl]morpholine, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(2S)-2-[4-(trifluoromethyl)phenyl]morpholine (CAS 2349772-26-3) is a chemical compound with the molecular formula C11H12F3NO and a molecular weight of 231.21 g/mol. IUPAC name: (2S)-2-[4-(trifluoromethyl)phenyl]morpholine. InChIKey: OMFWOWNSVWSVBC-SNVBAGLBSA-N.
| Molecular formula | C11H12F3NO |
|---|---|
| Molecular weight | 231.21 g/mol |
| IUPAC name | (2S)-2-[4-(trifluoromethyl)phenyl]morpholine |
| InChIKey | OMFWOWNSVWSVBC-SNVBAGLBSA-N |
| SMILES | C1CO[C@H](CN1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)