CAS 2350001-71-5 is the registry number for (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-(2,6-difluorophenyl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(2,6-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 2350001-71-5) is a chemical compound with the molecular formula C23H17F2NO4 and a molecular weight of 409.4 g/mol. IUPAC name: (2R)-2-(2,6-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: DBMFFZYWHYFRLO-OAQYLSRUSA-N.
| Molecular formula | C23H17F2NO4 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | (2R)-2-(2,6-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | DBMFFZYWHYFRLO-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](C4=C(C=CC=C4F)F)C(=O)O |
Computed by PubChem (NCBI)