CAS 678988-22-2 is the registry number for 2-(2,5-Difluorophenyl)-2-({((9H-fluoren-9-yl)methoxy)carbonyl}amino)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(2,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 678988-22-2) is a chemical compound with the molecular formula C23H17F2NO4 and a molecular weight of 409.4 g/mol. IUPAC name: 2-(2,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: IFRHOKKAJGRVJG-UHFFFAOYSA-N.
| Molecular formula | C23H17F2NO4 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | 2-(2,5-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | IFRHOKKAJGRVJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(C4=C(C=CC(=C4)F)F)C(=O)O |
Computed by PubChem (NCBI)