CAS 2350064-89-8 appears in our catalog under these names: Fmoc-PhNva2C-OH 98%, Fmoc-(S)-2-amino-5-(2-chlorophenyl)pentanoic acid, ≥95%, ≥95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2S)-5-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 2350064-89-8) is a chemical compound with the molecular formula C26H24ClNO4 and a molecular weight of 449.9 g/mol. IUPAC name: (2S)-5-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: BGNDJEGKHYUYQI-DEOSSOPVSA-N.
| Molecular formula | C26H24ClNO4 |
|---|---|
| Molecular weight | 449.9 g/mol |
| IUPAC name | (2S)-5-(2-chlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | BGNDJEGKHYUYQI-DEOSSOPVSA-N |
| SMILES | C1=CC=C(C(=C1)CCC[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)Cl |
Computed by PubChem (NCBI)