CAS 2350135-28-1 is the registry number for (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-(2,6-difluorophenyl)pentanoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-5-(2,6-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid (CAS 2350135-28-1) is a chemical compound with the molecular formula C26H23F2NO4 and a molecular weight of 451.5 g/mol. IUPAC name: (2S)-5-(2,6-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid. InChIKey: GTXHQGYFPVFITH-DEOSSOPVSA-N.
| Molecular formula | C26H23F2NO4 |
|---|---|
| Molecular weight | 451.5 g/mol |
| IUPAC name | (2S)-5-(2,6-difluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanoic acid |
| InChIKey | GTXHQGYFPVFITH-DEOSSOPVSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCC4=C(C=CC=C4F)F)C(=O)O |
Computed by PubChem (NCBI)