CAS 2350191-05-6 is the registry number for 4-(2,2,2-tribromo-1-hydroxyethyl)benzonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(2,2,2-tribromo-1-hydroxyethyl)benzonitrile (CAS 2350191-05-6) is a chemical compound with the molecular formula C9H6Br3NO and a molecular weight of 383.86 g/mol. IUPAC name: 4-(2,2,2-tribromo-1-hydroxyethyl)benzonitrile. InChIKey: AOVCMCMBEQKWDI-UHFFFAOYSA-N.
| Molecular formula | C9H6Br3NO |
|---|---|
| Molecular weight | 383.86 g/mol |
| IUPAC name | 4-(2,2,2-tribromo-1-hydroxyethyl)benzonitrile |
| InChIKey | AOVCMCMBEQKWDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(C(Br)(Br)Br)O |
Computed by PubChem (NCBI)