CAS 2350614-77-4 is the registry number for (2S)-2-(Fmoc-amino)-4-(3- isoquinolyl)butanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-isoquinolin-3-ylbutanoic acid (CAS 2350614-77-4) is a chemical compound with the molecular formula C28H24N2O4 and a molecular weight of 452.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-isoquinolin-3-ylbutanoic acid. InChIKey: SQKCABVNFJNSBD-SANMLTNESA-N.
| Molecular formula | C28H24N2O4 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-isoquinolin-3-ylbutanoic acid |
| InChIKey | SQKCABVNFJNSBD-SANMLTNESA-N |
| SMILES | C1=CC=C2C=NC(=CC2=C1)CC[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)