CAS 235101-85-6 appears in our catalog under these names: 6–(Trifluoromethoxy)benzo(d)thiazole–2(3H)–thione, 6-(Trifluoromethoxy)benzo[d]thiazole-2(3H)-thione. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 50mg.
6-(trifluoromethoxy)-3H-1,3-benzothiazole-2-thione (CAS 235101-85-6) is a chemical compound with the molecular formula C8H4F3NOS2 and a molecular weight of 251.3 g/mol. IUPAC name: 6-(trifluoromethoxy)-3H-1,3-benzothiazole-2-thione. InChIKey: RBTZKWXZXZEIEF-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NOS2 |
|---|---|
| Molecular weight | 251.3 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-3H-1,3-benzothiazole-2-thione |
| InChIKey | RBTZKWXZXZEIEF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)SC(=S)N2 |
Computed by PubChem (NCBI)