Products 23517-02-4
CAS 23517-02-4 is the registry number for (-)-Byakangelicin. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-[(2S)-2,3-dihydroxy-3-methylbutoxy]-4-methoxyfuro[3,2-g]chromen-7-one (CAS 23517-02-4) is a chemical compound with the molecular formula C17H18O7 and a molecular weight of 334.3 g/mol. IUPAC name: 9-[(2S)-2,3-dihydroxy-3-methylbutoxy]-4-methoxyfuro[3,2-g]chromen-7-one. InChIKey: PKRPFNXROFUNDE-NSHDSACASA-N.
| Molecular formula | C17H18O7 |
|---|---|
| Molecular weight | 334.3 g/mol |
| IUPAC name | 9-[(2S)-2,3-dihydroxy-3-methylbutoxy]-4-methoxyfuro[3,2-g]chromen-7-one |
| InChIKey | PKRPFNXROFUNDE-NSHDSACASA-N |
| SMILES | CC(C)([C@H](COC1=C2C(=C(C3=C1OC(=O)C=C3)OC)C=CO2)O)O |
Computed by PubChem (NCBI)