CAS 2353409-75-1 appears in our catalog under these names: 3-(M-Peg8-ethoxycarbonyl)propanoic acid, 95%, m–PEG8–ethoxycarbonyl–propanoic acid, m-PEG8-ethoxycarbonyl-propanoic acid 95%, m-PEG8-ethoxycarbonyl-propanoic acid. Offered by: Combi-blocks, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 250mg, 500mg, 1g, 100mg, 25 mg, 250 mg, 100 mg, 1 g.
4-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid (CAS 2353409-75-1) is a chemical compound with the molecular formula C21H40O12 and a molecular weight of 484.5 g/mol. IUPAC name: 4-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid. InChIKey: PTPATACFPISKEY-UHFFFAOYSA-N.
| Molecular formula | C21H40O12 |
|---|---|
| Molecular weight | 484.5 g/mol |
| IUPAC name | 4-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
| InChIKey | PTPATACFPISKEY-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOC(=O)CCC(=O)O |
Computed by PubChem (NCBI)