CAS 2353599-81-0 is the registry number for 3-(5-bromo-2-chloropyridin-4-yl)-1,1,1-trifluoropropan-2-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(5-bromo-2-chloro-4-pyridinyl)-1,1,1-trifluoropropan-2-ol (CAS 2353599-81-0) is a chemical compound with the molecular formula C8H6BrClF3NO and a molecular weight of 304.49 g/mol. IUPAC name: 3-(5-bromo-2-chloro-4-pyridinyl)-1,1,1-trifluoropropan-2-ol. InChIKey: CLCGIRNZRIUVPG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClF3NO |
|---|---|
| Molecular weight | 304.49 g/mol |
| IUPAC name | 3-(5-bromo-2-chloro-4-pyridinyl)-1,1,1-trifluoropropan-2-ol |
| InChIKey | CLCGIRNZRIUVPG-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)Br)CC(C(F)(F)F)O |
Computed by PubChem (NCBI)