CAS 235439-56-2 appears in our catalog under these names: tert-Butyl (S)-(1-(3,4-dichlorophenyl)-3-hydroxypropan-2-yl)carbamate, 98%, N-Boc-D-3,4-Dichlorophenylalaninol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
Tert-butyl N-[(2R)-1-(3,4-dichlorophenyl)-3-hydroxypropan-2-yl]carbamate (CAS 235439-56-2) is a chemical compound with the molecular formula C14H19Cl2NO3 and a molecular weight of 320.2 g/mol. IUPAC name: tert-butyl N-[(2R)-1-(3,4-dichlorophenyl)-3-hydroxypropan-2-yl]carbamate. InChIKey: IJGQDOXDMWLOHD-SNVBAGLBSA-N.
| Molecular formula | C14H19Cl2NO3 |
|---|---|
| Molecular weight | 320.2 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-(3,4-dichlorophenyl)-3-hydroxypropan-2-yl]carbamate |
| InChIKey | IJGQDOXDMWLOHD-SNVBAGLBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=C(C=C1)Cl)Cl)CO |
Computed by PubChem (NCBI)