CAS 2354405-14-2 appears in our catalog under these names: FAK inhibitor 2, 98%, FAK inhibitor 2, 98.26%, FAK inhibitor 2, 98.16%, 98.16%. Offered by: AmBeed, MedChemExpress, Chemat. Available pack sizes: 100mg, 10mM/1mL, 50 mg, 5 mg, 25 mg, 100 mg, 10 mg, 1mg.
2-(dimethylamino)ethyl 4-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzoyl]piperazine-1-carbodithioate (CAS 2354405-14-2) is a chemical compound with the molecular formula C29H33F3N8O2S2 and a molecular weight of 646.8 g/mol. IUPAC name: 2-(dimethylamino)ethyl 4-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzoyl]piperazine-1-carbodithioate. InChIKey: UXDPRPCEEZGHNQ-UHFFFAOYSA-N.
| Molecular formula | C29H33F3N8O2S2 |
|---|---|
| Molecular weight | 646.8 g/mol |
| IUPAC name | 2-(dimethylamino)ethyl 4-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzoyl]piperazine-1-carbodithioate |
| InChIKey | UXDPRPCEEZGHNQ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC=CC=C1NC2=NC(=NC=C2C(F)(F)F)NC3=CC=C(C=C3)C(=O)N4CCN(CC4)C(=S)SCCN(C)C |
Computed by PubChem (NCBI)