Products 2355477-05-1

CAS 2355477-05-1 is the registry number for tert-Butyl dec-9-yn-1-ylcarbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-dec-9-ynylcarbamate (CAS 2355477-05-1) is a chemical compound with the molecular formula C15H27NO2 and a molecular weight of 253.38 g/mol. IUPAC name: tert-butyl N-dec-9-ynylcarbamate. InChIKey: UCBHXYQGZVJJKO-UHFFFAOYSA-N.

Identity
Molecular formulaC15H27NO2
Molecular weight253.38 g/mol
IUPAC nametert-butyl N-dec-9-ynylcarbamate
InChIKeyUCBHXYQGZVJJKO-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCCCCCCCC#C

Computed by PubChem (NCBI)