CAS 23558-08-9 appears in our catalog under these names: Fructose-1,6-diphosphate sodium salt, 96%, D-Fructose, 1,6-bis(dihydrogen phosphate), sodium salt(1:x), 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 100g, 500g, 25g, 5g, on request.
CAS 23558-08-9 identifies a chemical compound with the molecular formula C6H14NaO12P2 and a molecular weight of 363.11 g/mol. InChIKey: QXMOBZYUBFCQPG-BAOOBMCLSA-N.
| Molecular formula | C6H14NaO12P2 |
|---|---|
| Molecular weight | 363.11 g/mol |
| InChIKey | QXMOBZYUBFCQPG-BAOOBMCLSA-N |
| SMILES | C([C@H]([C@H]([C@@H](C(=O)COP(=O)(O)O)O)O)O)OP(=O)(O)O.[Na] |
Computed by PubChem (NCBI)