Products 2356-55-0

CAS 2356-55-0 is the registry number for 2-Bromo-1,2,2-trifluoroethyl trifluoromethyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane (CAS 2356-55-0) is a chemical compound with the molecular formula C3HBrF6O and a molecular weight of 246.93 g/mol. IUPAC name: 1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane. InChIKey: PJLXAVKTUMSCKH-UHFFFAOYSA-N.

Identity
Molecular formulaC3HBrF6O
Molecular weight246.93 g/mol
IUPAC name1-bromo-1,1,2-trifluoro-2-(trifluoromethoxy)ethane
InChIKeyPJLXAVKTUMSCKH-UHFFFAOYSA-N
SMILESC(C(F)(F)Br)(OC(F)(F)F)F

Computed by PubChem (NCBI)