CAS 2356153-95-0 appears in our catalog under these names: Celecoxib Impurity 5, Celecoxib Impurity 41. Offered by: Chemat Brand. Available pack sizes: on request.
4-[5-(4-methylphenyl)-2-oxido-3-(trifluoromethyl)pyrazol-2-ium-1-yl]benzenesulfonamide (CAS 2356153-95-0) is a chemical compound with the molecular formula C17H14F3N3O3S and a molecular weight of 397.4 g/mol. IUPAC name: 4-[5-(4-methylphenyl)-2-oxido-3-(trifluoromethyl)pyrazol-2-ium-1-yl]benzenesulfonamide. InChIKey: XDRYFQCOBXEFKT-UHFFFAOYSA-N.
| Molecular formula | C17H14F3N3O3S |
|---|---|
| Molecular weight | 397.4 g/mol |
| IUPAC name | 4-[5-(4-methylphenyl)-2-oxido-3-(trifluoromethyl)pyrazol-2-ium-1-yl]benzenesulfonamide |
| InChIKey | XDRYFQCOBXEFKT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=[N+](N2C3=CC=C(C=C3)S(=O)(=O)N)[O-])C(F)(F)F |
Computed by PubChem (NCBI)