CAS 23569-17-7 appears in our catalog under these names: 4-tert-Butylpyridine 1-oxide, 95%, 4-tert-Butylpyridine 1-oxide, 95-<97%, 4-tert-Butylpyridine 1-oxide, ≥97-<99%, 4-(tert-Butyl)pyridine 1-Oxide, >98.0%(GC), 4-tert-Butylpyridine 1-oxide 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, TCI, Ambeed, Chemat. Available pack sizes: 250mg, 10g, 25g, 50g, 100g, 200g, 300g, 100mg.
4-tert-butyl-1-oxidopyridin-1-ium (CAS 23569-17-7) is a chemical compound with the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. IUPAC name: 4-tert-butyl-1-oxidopyridin-1-ium. InChIKey: CMFQXPIZAKBRCG-UHFFFAOYSA-N.
| Molecular formula | C9H13NO |
|---|---|
| Molecular weight | 151.21 g/mol |
| IUPAC name | 4-tert-butyl-1-oxidopyridin-1-ium |
| InChIKey | CMFQXPIZAKBRCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=[N+](C=C1)[O-] |
Computed by PubChem (NCBI)