CAS 2357-51-9 appears in our catalog under these names: Fast red B tetrafluoroborate salt, (2-Methoxy-4-nitrophenyl)Diazenium tetrafluoroborate. Offered by: GLPBio, Biosynth. Available pack sizes: 25g, 5g, 0,5g.
2-methoxy-4-nitrobenzenediazonium tetrafluoroborate (CAS 2357-51-9) is a chemical compound with the molecular formula C7H6BF4N3O3 and a molecular weight of 266.95 g/mol. IUPAC name: 2-methoxy-4-nitrobenzenediazonium tetrafluoroborate. InChIKey: GYYABOARHFFQTR-UHFFFAOYSA-N.
| Molecular formula | C7H6BF4N3O3 |
|---|---|
| Molecular weight | 266.95 g/mol |
| IUPAC name | 2-methoxy-4-nitrobenzenediazonium tetrafluoroborate |
| InChIKey | GYYABOARHFFQTR-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.COC1=C(C=CC(=C1)[N+](=O)[O-])[N+]#N |
Computed by PubChem (NCBI)