CAS 2357110-84-8 appears in our catalog under these names: Thalidomide-4-C3-NH2 HCl, 98%, Thalidomide–4–C3–NH2 hydrochloride, Thalidomide-4-C3-NH2 (hydrochloride). Offered by: AmBeed, GLPBio, MedChemExpress. Available pack sizes: 1g, 5g, 1mg, 5mg, Get quote.
5-(3-aminopropyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride (CAS 2357110-84-8) is a chemical compound with the molecular formula C16H18ClN3O4 and a molecular weight of 351.78 g/mol. IUPAC name: 5-(3-aminopropyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride. InChIKey: VHFJERMPPMWSPF-UHFFFAOYSA-N.
| Molecular formula | C16H18ClN3O4 |
|---|---|
| Molecular weight | 351.78 g/mol |
| IUPAC name | 5-(3-aminopropyl)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;hydrochloride |
| InChIKey | VHFJERMPPMWSPF-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)CCCN.Cl |
Computed by PubChem (NCBI)