CAS 2357114-90-8 is the registry number for tert-Butyl ((2-(2,6-dioxopiperidin-3-yl)-1-oxoisoindolin-5-yl)methyl)carbamate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]carbamate (CAS 2357114-90-8) is a chemical compound with the molecular formula C19H23N3O5 and a molecular weight of 373.4 g/mol. IUPAC name: tert-butyl N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]carbamate. InChIKey: KLJMOQDPIZUJLA-UHFFFAOYSA-N.
| Molecular formula | C19H23N3O5 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | tert-butyl N-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]methyl]carbamate |
| InChIKey | KLJMOQDPIZUJLA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC2=C(C=C1)C(=O)N(C2)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)