CAS 2357185-47-6 is the registry number for 5-(5,5-Dioxido-10H-phenothiazin-10-yl)isophthalic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-(5,5-dioxophenothiazin-10-yl)benzene-1,3-dicarboxylic acid (CAS 2357185-47-6) is a chemical compound with the molecular formula C20H13NO6S and a molecular weight of 395.4 g/mol. IUPAC name: 5-(5,5-dioxophenothiazin-10-yl)benzene-1,3-dicarboxylic acid. InChIKey: GEYSPNCZDUQKDQ-UHFFFAOYSA-N.
| Molecular formula | C20H13NO6S |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 5-(5,5-dioxophenothiazin-10-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | GEYSPNCZDUQKDQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2(=O)=O)C4=CC(=CC(=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)