CAS 23576-23-0 appears in our catalog under these names: 4-Chloro-5-(dimethylamino)-2-(3-(trifluoromethyl)phenyl)pyridazin-3(2H)-one, Metflurazon. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 250mg, 500mg, 50mg, 25mg, 1x25mg.
4-chloro-5-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one (CAS 23576-23-0) is a chemical compound with the molecular formula C13H11ClF3N3O and a molecular weight of 317.69 g/mol. IUPAC name: 4-chloro-5-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one. InChIKey: CYQMVKQKBFFDOO-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3N3O |
|---|---|
| Molecular weight | 317.69 g/mol |
| IUPAC name | 4-chloro-5-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one |
| InChIKey | CYQMVKQKBFFDOO-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=O)N(N=C1)C2=CC=CC(=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)