CAS 23578-23-6 appears in our catalog under these names: Copper(II) isopropoxide, 98% (metals basis) , Copper(II) propan-2-olate, ≥98%(metals basis), ≥98%(metals basis). Offered by: Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 1g, 5g, 25g.
Copper bis(propan-2-olate) (CAS 23578-23-6) is a chemical compound with the molecular formula C6H14CuO2 and a molecular weight of 181.72 g/mol. IUPAC name: copper bis(propan-2-olate). InChIKey: VNGORJHUDAPOQZ-UHFFFAOYSA-N.
| Molecular formula | C6H14CuO2 |
|---|---|
| Molecular weight | 181.72 g/mol |
| IUPAC name | copper bis(propan-2-olate) |
| InChIKey | VNGORJHUDAPOQZ-UHFFFAOYSA-N |
| SMILES | CC(C)[O-].CC(C)[O-].[Cu+2] |
Computed by PubChem (NCBI)