CAS 2357953-00-3 appears in our catalog under these names: 2,2-Dibromo-1-(3-chlorophenyl)propan-1-one, Bupropion Impurity 23. Offered by: TRC, Chemat Brand. Available pack sizes: 250mg, on request.
2,2-dibromo-1-(3-chlorophenyl)propan-1-one (CAS 2357953-00-3) is a chemical compound with the molecular formula C9H7Br2ClO and a molecular weight of 326.41 g/mol. IUPAC name: 2,2-dibromo-1-(3-chlorophenyl)propan-1-one. InChIKey: QUERXRKOSMDGLY-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2ClO |
|---|---|
| Molecular weight | 326.41 g/mol |
| IUPAC name | 2,2-dibromo-1-(3-chlorophenyl)propan-1-one |
| InChIKey | QUERXRKOSMDGLY-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC=C1)Cl)(Br)Br |
Computed by PubChem (NCBI)