CAS 2358751-19-4 is the registry number for 4-Bromo-3-iodo-1-(2,2,2-trifluoro-ethyl)-1h-pyrrolo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-3-iodo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine (CAS 2358751-19-4) is a chemical compound with the molecular formula C9H5BrF3IN2 and a molecular weight of 404.95 g/mol. IUPAC name: 4-bromo-3-iodo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine. InChIKey: KZQVINHEXRPMPP-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3IN2 |
|---|---|
| Molecular weight | 404.95 g/mol |
| IUPAC name | 4-bromo-3-iodo-1-(2,2,2-trifluoroethyl)pyrrolo[2,3-b]pyridine |
| InChIKey | KZQVINHEXRPMPP-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1Br)C(=CN2CC(F)(F)F)I |
Computed by PubChem (NCBI)