CAS 2358751-30-9 is the registry number for 4-Bromo-1-cyclohexylmethyl-3-iodo-1h-pyrrolo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-bromo-1-(cyclohexylmethyl)-3-iodopyrrolo[2,3-b]pyridine (CAS 2358751-30-9) is a chemical compound with the molecular formula C14H16BrIN2 and a molecular weight of 419.10 g/mol. IUPAC name: 4-bromo-1-(cyclohexylmethyl)-3-iodopyrrolo[2,3-b]pyridine. InChIKey: FYZVJOXYCUSPHQ-UHFFFAOYSA-N.
| Molecular formula | C14H16BrIN2 |
|---|---|
| Molecular weight | 419.10 g/mol |
| IUPAC name | 4-bromo-1-(cyclohexylmethyl)-3-iodopyrrolo[2,3-b]pyridine |
| InChIKey | FYZVJOXYCUSPHQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)CN2C=C(C3=C(C=CN=C32)Br)I |
Computed by PubChem (NCBI)