Products 2358751-53-6
CAS 2358751-53-6 is the registry number for 1-(3-Fluoro-5-(trifluoromethyl)phenyl)propan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride (CAS 2358751-53-6) is a chemical compound with the molecular formula C10H12ClF4N and a molecular weight of 257.65 g/mol. IUPAC name: 1-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride. InChIKey: NVDXPQFSBQXILH-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF4N |
|---|---|
| Molecular weight | 257.65 g/mol |
| IUPAC name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]propan-1-amine;hydrochloride |
| InChIKey | NVDXPQFSBQXILH-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=CC(=C1)F)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)