CAS 2359605-45-9 is the registry number for 2',2'',5',5''-Tetramethyl-[1,1':4',1'':4'',1'''-quaterphenyl]-4,4'''-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[4-(4-carboxyphenyl)-2,5-dimethylphenyl]-2,5-dimethylphenyl]benzoic acid (CAS 2359605-45-9) is a chemical compound with the molecular formula C30H26O4 and a molecular weight of 450.5 g/mol. IUPAC name: 4-[4-[4-(4-carboxyphenyl)-2,5-dimethylphenyl]-2,5-dimethylphenyl]benzoic acid. InChIKey: ZHKVSQPGOFKKCO-UHFFFAOYSA-N.
| Molecular formula | C30H26O4 |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | 4-[4-[4-(4-carboxyphenyl)-2,5-dimethylphenyl]-2,5-dimethylphenyl]benzoic acid |
| InChIKey | ZHKVSQPGOFKKCO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C2=CC(=C(C=C2C)C3=CC=C(C=C3)C(=O)O)C)C)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)