CAS 693436-80-5 is the registry number for Poly((9,9-dioctylfluorenyl-2,7-diyl)-co-(1,4-phenylene))end capped with dimethylphenyl. Offered by: Lumtec. Available pack sizes: On request.
9,10-bis(3,5-dimethoxyphenyl)anthracene (CAS 693436-80-5) is a chemical compound with the molecular formula C30H26O4 and a molecular weight of 450.5 g/mol. IUPAC name: 9,10-bis(3,5-dimethoxyphenyl)anthracene. InChIKey: ANNLXUDHOREGON-UHFFFAOYSA-N.
| Molecular formula | C30H26O4 |
|---|---|
| Molecular weight | 450.5 g/mol |
| IUPAC name | 9,10-bis(3,5-dimethoxyphenyl)anthracene |
| InChIKey | ANNLXUDHOREGON-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=C3C=CC=CC3=C(C4=CC=CC=C42)C5=CC(=CC(=C5)OC)OC)OC |
Computed by PubChem (NCBI)