Products 23602-98-4

CAS 23602-98-4 appears in our catalog under these names: Dibenzo[b,d]furan-2-sulfonyl chloride, 97%, Dibenzo(b,d)furan-2-sulfonyl chloride, Dibenzo[b,d]furan-2-sulfonyl chloride 95%, Dibenzo[b,d]furan-2-sulfonyl chloride, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Dibenzofuran-2-sulfonyl chloride (CAS 23602-98-4) is a chemical compound with the molecular formula C12H7ClO3S and a molecular weight of 266.70 g/mol. IUPAC name: dibenzofuran-2-sulfonyl chloride. InChIKey: ULCKEERECJMLHP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7ClO3S
Molecular weight266.70 g/mol
IUPAC namedibenzofuran-2-sulfonyl chloride
InChIKeyULCKEERECJMLHP-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)S(=O)(=O)Cl

Computed by PubChem (NCBI)