Products 2360625-88-1
CAS 2360625-88-1 is the registry number for 3-Iodo-7,7-dimethyl-1,6,7,8-tetrahydro-4H-dipyrrolo[1,2-a:2',3'-d]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-iodo-11,11-dimethyl-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one (CAS 2360625-88-1) is a chemical compound with the molecular formula C11H12IN3O and a molecular weight of 329.14 g/mol. IUPAC name: 4-iodo-11,11-dimethyl-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one. InChIKey: LFECOSMMBHXJGD-UHFFFAOYSA-N.
| Molecular formula | C11H12IN3O |
|---|---|
| Molecular weight | 329.14 g/mol |
| IUPAC name | 4-iodo-11,11-dimethyl-1,6,8-triazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-2-one |
| InChIKey | LFECOSMMBHXJGD-UHFFFAOYSA-N |
| SMILES | CC1(CC2=NC3=C(C(=CN3)I)C(=O)N2C1)C |
Computed by PubChem (NCBI)